Questions LLC
Login
or
Sign Up
Ask a New Question
Science
Chemistry
What is the name of 12H2O and 10 H2O?
1 answer
12 is dodecahydrate and 10 is decahydrate
You can
ask a new question
or
answer this question
.
Related Questions
If 1.0 g samples of each compound were
dehydrated, which sample would lose the greatest mass of water? Molar Masses: LiCl* H2O=
is KAl(SO4)2 12H2O hygroscopic, deliquescent, or efflorescent?
Determine pH of each solution:
0.20 M KI i don't know how you know if you use.. K+H2O->KOH + H or... I- +H2O--> HIO +H Im
Which of the following chemical reactions represents a neutralization reaction?
A. CH4 + 2O2 CO2 + H2O B. HCl + NaOH H2O + NaCl
The thermal decomposition of 1.6608 g of MgSO4 * H2O produces 1.4446 g of a
product in a well-behaved reaction. There are two
Which of the following processes is endothermic?
a) H2O (g) --> H2O (l) b) 3O2 (g) + 2CH3OH(g) --> 2CO2(g) + 2H2O(g) c) H2O (s)
In a solution prepared by mixing CH3OH with H2O the major species pesent are
1. a. CH3+, OH, and H2O 2. b. CH3O, H+, and H2O 3.
What chemical equation represents the ability of a substance to donate a proton in water?
A. NH3 + H2O <-> NH4+ + OH- B. CH3COOH
Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4
Predict the product(s) for the following reaction:
H2SO4(aq) + KOH(aq) --> Choose one answer. a. K(s) + H2(g) + SO3(g) b.