Questions LLC
Login
or
Sign Up
Ask a New Question
Chemistry
Chemical Reactions
Balancing Equations
what is the balanced equation of H+ + [Al(OH4]-
and
[Al(H2O)6]3+ + K+ + SO4
1 answer
AL (OH)2 CI
You can
ask a new question
or
answer this question
.
Related Questions
Which one of the following is not a redox reaction?
A. H2O(l) + NH3(g) → NH4+(aq) + OH¯(aq) B. 2H2(g) + O2(g) → 2H2O(l) C.
Balance this chemical equation.
K4Fe(CN)6 + KMnO4 + H2SO4 ---> KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O
Write a balanced chemical equation for the reaction of propylamine with water.
Is propylamine --> CH3CH2CH2NH2? Is the equation
Enter the balanced complete ionic equation for HCl(aq)+K2CO3(aq)→H2O(l)+CO2(g)+KCl(aq)
Would it be: 2H+(aq) + 2Cl^-(aq) +
When the equation
Fe2(SO4)3(aq) + 3Ba(OH)2(aq) ! is completed and balanced, a term in the balanced equation is 1. 2 Fe(OH)(s). 2.
Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4
Caluclate the delta H for this reaction using standard enthalpies of formation. (The standard enthalpy of formation of liquid
Calculate the volume (in mL) of 9.0M H2SO4 that you would need to convert 0.070 moles of KAl(OH)4 to K2SO4 and Al2(SO4)3
When butane undergoes complete combustion , the products are CO2 and H2O
C4H10(g) + O2(g)-> CO2(g) + H2O(g) What is the value of
KOH + F2 ->KF+F2O+H2O
which option shows a correctly balanced chemical equation 3KOH + F2->3KF+2F2O+H20 3KPH+3F2->KF+F2O+2H2O