Login or Sign Up

Ask a New Question

joel

Questions and answers by joel

Questions (81)

Question 4. (50 points)In an auction in the market for wholesale electricity, producers of electricity submit bids for each
1. 1 answer
2. 373 views
evaluate: integration of x^2 (square root of (1-2x^3))dx
1. 3 answers
2. 371 views
evaluate: integration of x^2 (square root of (1-2x^3))dx
1. 1 answer
2. 335 views
find the integral of square root of 1+x^3 dx or sqrt(1+ x^3)dx
1. 1 answer
2. 274 views
find the integral of square root of 1+x^3 dx or sqrt(1+ x^3)dx
1. 2 answers
2. 858 views
what is gnama artea it means Kings must follow laws too.
1. 1 answer
2. 359 views
how do geologists determine the texture of a rock
1. 1 answer
2. 502 views
Given sina= 3/4 and cosB = (-5)/13 and this is Quad II find cos(a+B)
1. 2 answers
2. 503 views
Given sina= 3/4 and cosB = (-5)/13 and this is Quad II find cos(a+B)
1. 1 answer
2. 482 views
what are the zeroes of the graph 2sin(squared)x + cosx-3 = 0
1. 1 answer
2. 362 views
If sinu = -5/7 and pie<u<3pie/2 find 2uDoes anyone know the answer to this (not the steps for solving I know that my answer just
1. 1 answer
2. 464 views
An airplane left an airport and flew east 174 miles. Then it turned northward flying along a bearing of N22E. When it was 254
1. 4 answers
2. 1,906 views
Axum's conversion to Christianitya. beneficial b. a drawback c. first a drawback then beneficial d. first beneficial then a
1. 6 answers
2. 759 views
what is the tan of 25 degrees and 01 minute
1. 3 answers
2. 354 views
I need the complete predicate in this sentence? Ida B. Wells was born into slavery in 1862 in Holly Springs, Mississippi.
1. 2 answers
2. 1,193 views
in which number does 4 have the greatest value 9499 4391 2240 1944
1. 1 answer
2. 381 views
Tyrell says $750 is about $800.Sara says $750 is about $700.who is correct?explain.
1. 5 answers
2. 729 views
Write a missing addend addition sentence to help solve 78-49.explain how you would use it.
1. 2 answers
2. 647 views
Select the set of equations that represents the following situation: Mike invested $706 for one year. He invested part of it at
1. 3 answers
2. 493 views
Did I punctuate this correctly? "Daddy, why is the sky blue?" Martinique asked her father.the quotation mark goes behind the
1. 3 answers
2. 667 views
I'm going to be asking for the help for all of usdoes this have correct punctuation? two of us said no and the other two says
1. 1 answer
2. 441 views
we are really stuck on this one we searched the website that you suggested but are still stuck this is what we came up with is
1. 2 answers
2. 851 views
The defendant stated that she was, "not guilty."is this correct punctuation?
1. 3 answers
2. 452 views
Ms. Sardelis said we must "absolutely and without delay" turn in our permission slips by tomorrow or we can't go on the class
1. 3 answers
2. 960 views
My mom says "Never wear anything but a suit to a funeral or a wedding."is this correct punctuation?
1. 9 answers
2. 506 views
Antony invited us over to check out his, "awesome new board."is this correct
1. 4 answers
2. 993 views
When Marcos walked into the room, we turned on the lights and yelled, "Happy birthday!"is this correct punctuation?
1. 3 answers
2. 536 views
"Ouch, that hurts!," Kadra said after stubbing her toe.is this correct?
1. 3 answers
2. 578 views
"Maybe we should wait to begin until everyone is seated," Ana said to her band mates.did I punctuate this correctly?
1. 4 answers
2. 635 views
What did the philosopher Aristotle mean when he said, "To perceive is to suffer"?Did I punctuate correctly?
1. 3 answers
2. 1,667 views
Jocelyn asked her mom, "What was it like when you were a child?"Did I punctuate correctly?
1. 2 answers
2. 668 views
"One day I'm going to be an astronaut," Adelle told her sister.Did I punctuate correctly?
1. 3 answers
2. 577 views
n 1946, Albert Einstein said if he had known the Germans wouldn't succeed in constructing the atom bomb, he "would never have
1. 2 answers
2. 544 views
what is the allusion.Last year our school’s finances were in shambles. Overspending and little control over money has resulted
1. 6 answers
2. 783 views
What is the historical allusion?For the last several months, Rebecca had been working with her team on raising money in her
1. 5 answers
2. 587 views
Copán is one of the most impressive sites for ruins of the ancient Maya civilization. Situated in western Honduras, Copán is
1. 5 answers
2. 1,118 views
Dresden was a German city destroyed by the allies in WWII. Which of the following most likely describes the allusion to Dresden?
1. 3 answers
2. 1,094 views
Essay; show all work. Bob’s Barber Shop estimates their gross revenue for the second quarter to be given by the polynomial 2x3
1. 1 answer
2. 449 views
Essay; show all work. Consider that the age, x, of a unicorn in human equivalent years can be given by the formula f(x) = -
1. 1 answer
2. 416 views
There are 2 packets of flour, Y & Z.The ratio of the mass of Y to Z is 4:1. If 26g is added to Z,the ratio of the mass of Y to Z
1. 3 answers
2. 400 views
the moon orbits the earth in a circle (near enough) of radious 3.8x10^8 m, taking 27.3 days to make a complete orbit.what is the
1. 2 answers
2. 1,093 views
The average mass of half the number of crabs in a basket is 350g, the average mass of the remaining crabs is 300g. If the total
1. 3 answers
2. 399 views
the amount of metal in the nut?
1. 1 answer
2. 281 views
use each of the digits 0 1 3 4 5 exactly once to write a decimal subtraction problem.the difference must be the same as one of
1. 3 answers
2. 730 views
1) Salary levels are determined by a number of important factors such as the years of experience, education level, job
1. 1 answer
2. 370 views
A bond that has a $1000 par value (face value) and a contract or coupon interest rate of 11.5. The bonds have a current value of
1. 2 answers
2. 669 views
is it possible for one molecule of salicylic acid to form an ester with a second molecule of the same substance? Use equations
1. 1 answer
2. 374 views
is it possible for one molecule of salicylic acid to form an ester with a second molecule of the same substance? Use equations
1. 1 answer
2. 396 views
The Horizontal Assymptote for the graph of f(x) = (-6x3 +2x + 5)/(x3-1) is the horizontal line with equation y=___
1. 1 answer
2. 355 views
if i have a book of 30 pages and i want to number each pages what will be the digit for the thirty pages
1. 4 answers
2. 1,029 views
if i have abook of 30 pages and i number each pages, how can i figure the digit number
1. 1 answer
2. 280 views
find the area under the curve y=3log1.2x between x = 1.2 and x = 3
1. 1 answer
2. 348 views
A cage descends a mine shaft with an acceleration of 0.5 m/s2. After the cage has travelled 25 metres,a stone is dropped from
1. 4 answers
2. 4,098 views
A flywheel is making 180 r.p.m. and after 20 seconds it is running at 140 r.p.m. How many revolutionswill it make, and what time
1. 7 answers
2. 6,844 views
A locomotive is running at a constant speed of 100 km/ h. The diameter of driving wheels is 1.8 m. Thestroke of the piston of
1. 1 answer
2. 674 views
Solutions of sodium carbonate and silver nitrate react to form solid silver carbonate and a solution of sodium nitrate. A
1. 4 answers
2. 2,233 views
A sequence has the following pattern 3/2,4,15/2,12,35/2,24.Starting n=1 find the general term for the sequence?
1. 1 answer
2. 417 views
light that has a frequency of 1.5 x 1015 Hz.
1. 2 answers
2. 609 views
if a 3 gram French fry accelerating at 5 meter's per second. what is he fries force?
1. 3 answers
2. 435 views
Prove That Sin2A+SIN2B+SIN2C/SINA+SINB+SINC=8SinA/2SINB/2SINC/2
1. 1 answer
2. 861 views
A variable tangent to the ellipse (x/a)^2 +(y/b)^2 meets the parabola y^2=4ax at L and M. Find the locus of the midpoint of LM.
1. 2 answers
2. 572 views
Prove that in any triangle ABC Sin2A+Sin2B+Sin2C/SinA+SinB+SinC=8Sin(A/2)Sin(B/2)Sin(C/2)
1. 2 answers
2. 997 views
c. What do the slope and y-intercept mean in the context of this problem?Hint: What do you pay when you step into the cab?
1. 1 answer
2. 990 views
use the method of substitution to solve the following pairs of simultaneous equation. 2m+n=0,m+2n=3
1. 1 answer
2. 486 views
Which of the sentences below is an excerpt taken from "In Another Country" by Ernest Hemingway is an example of irony? A. My
1. 1 answer
2. 716 views
how many numbers are greater than 22 but less than 32?
1. 3 answers
2. 377 views
how many centavos are equal to P2.50
1. 4 answers
2. 364 views
I am a 2 digits number. My ones is 3 more than my tens and the sum of my digits is 11. What number am I?
1. 4 answers
2. 501 views
.) Dino gathered 72 eggs from one poultry house and 48 from another. How many more eggs did he gather from the first house?
1. 4 answers
2. 449 views
I am a 2-digit number. My ones is 3 more than my tens and the sum of my digits is 11. What number am I ?
1. 7 answers
2. 2,981 views
How many centavos are equal to P2.50?
1. 1 answer
2. 392 views
What is the ratio for the surface areas of the cones shown below, given that they are similar and that the ratio of their radii
1. 3 answers
2. 3,144 views
Question 1 of 10Multiple Choice: Please select the best answer and click "submit." A closet contains 8 pairs of pants, 10
1. 3 answers
2. 820 views
calculate the tax paid by a single person earning #110 600per annum
1. 1 answer
2. 342 views
There are 231 cubic inches in a gallon. A rectangular pitcher has a 4-inch by 5-inch base and a height of 10 inches. How many
1. 4 answers
2. 522 views
a(b-x)=CX
1. 1 answer
2. 110 views
Find the following limits analytically if they exist.Enter INF for positive infinity and -INF for negative infinity. If a limit
1. 1 answer
2. 314 views
there are 135 people in a sports center73 people use the gym 73 people use the swimming pool 67 people use the track 36 people
1. 3 answers
2. 811 views
what is the mean absolute deviation? 8 2 2 5 3 7 8
1. 1 answer
2. 246 views
Solve the equation or formula for the variable indicated.7 t = x , for t
1. 1 answer
2. 75 views
According to Marc, why did he and his first wife split up?
1. 1 answer
2. 56 views

Questions LLC

Use AI to answer your questions.

Ask a New Question

Company

About Us
Careers
Contact Us
Privacy Policy
Terms of Use

Questions

Archives
Categories
Newest
Random
Search

Trending

Now
Today
Week
Month
Year

Social

Facebook
Instagram
LinkedIn
YouTube
X

© 2024 Questions LLC. All rights reserved.