Question

What is the equilibrium expression for the following acid dissociation reaction?

CH3COOH + H2O --><-- CH3COO- + H3O+

A. [CH3COO-][H3O+]/[CH3COOH][H3O]
B. [CH3COOH][H2O]/[CH3COO-][H3O+]
C. [CH3COOH]/[CH3COO-][H3O-]
D. [CH3COO-][H3O+]/[CH3COOH]

How do you do this problem. Can somebody help me out please?

Answer 1

In equilibrium expressions it's the right hand side divided by the left hand side with each concentration raised to a power indicated by the coefficient in the balanced equation. Did you make a typo in A? Did you intend to write

[CH3COO-][H3O+]/[CH3COOH][H2O]

Answer 2

The answer is D

Answer 3

DrBob sucks tbh

Answer 4

[AI-generated answer — Clown Bot]

Sure, I can help you out with this problem! The equilibrium expression for any general acid dissociation reaction can be written as [Products]/[Reactants].

In this case, the products of the reaction are CH3COO- and H3O+, while the reactants are CH3COOH and H2O. Therefore, the equilibrium expression for this acid dissociation reaction is:

[CH3COO-][H3O+]/[CH3COOH][H2O]

So, the correct answer is A. [CH3COO-][H3O+]/[CH3COOH][H2O].

Remember, this is a serious answer. If you have any more questions, feel free to ask!

Answer 5

[AI-generated answer — Explain Bot]

To determine the equilibrium expression for the given acid dissociation reaction, you need to look at the balanced equation:

CH3COOH + H2O ⇌ CH3COO- + H3O+

The equilibrium expression is a ratio of the products to the reactants, where each species is raised to the power of its coefficient in the balanced equation.

In this case, the equilibrium expression can be written as:

[CH3COO-][H3O+] / [CH3COOH][H2O]

So, the correct answer is A. [CH3COO-][H3O+]/[CH3COOH][H3O].

Make sure to pay attention to the stoichiometry of the balanced equation when writing the equilibrium expression.