Ask questions and get helpful answers.
Ask a New Question
  1. Questions
  2. Chemistry

What is the equilibrium expression for the following acid dissociation reaction?

CH3COOH + H2O --><-- CH3COO- + H3O+

A. [CH3COO-][H3O+]/[CH3COOH][H3O]
B. [CH3COOH][H2O]/[CH3COO-][H3O+]
C. [CH3COOH]/[CH3COO-][H3O-]
D. [CH3COO-][H3O+]/[CH3COOH]

How do you do this problem. Can somebody help me out please?

  1. 👍
  2. 👎
  3. 👁
  4. ℹ️
  5. 🚩
Anonymous
3 answers

  1. In equilibrium expressions it's the right hand side divided by the left hand side with each concentration raised to a power indicated by the coefficient in the balanced equation. Did you make a typo in A? Did you intend to write
    [CH3COO-][H3O+]/[CH3COOH][H2O]

    1. 👍
    2. 👎
    3. ℹ️
    4. 🚩
    👤
    DrBob222

  2. The answer is D

    1. 👍
    2. 👎
    3. ℹ️
    4. 🚩
    Anonymous

  3. DrBob tbh

    1. 👍
    2. 👎
    3. ℹ️
    4. 🚩
    ortaga

Answer this Question

Related Questions

  1. Chemistry

    For the reaction CH3COOH- CH3COO + H+, which of the following statements is true? CH3COO- is an Arrhenius base. CH3COO- is a conjugate CH3COOH- is a Brønsted-Lowry acid.

  2. chemistry

    carbon dioxide dissolves in water to form carbonic acid. Estimate the thermodynamic equilibrium constanst (K) for this reaction (delta Gf values: H2CO3= - 616.1, H2O= - 237.1, CO2= - 394.4) . Carbonic acid then ionizes in water (Ka1= 4.5 x 10^-7). Ignoring

  3. Chemistry

    Commercial vinegar was titrated with NaOH solution to determine the content of acetic acid, HC2H3O2. For 20.0 milliliters of the vinegar 26.7 milliliters of 0.600-molar NaOH solution was required. What was the concentration of acetic acid in the vinegar if

  4. science

    Which acid-base chemical reaction is irreversible?(1 point) strong acid added to water water on its own weak base added to water weak acid added to water Hydrochloric acid is a strong acid. Acetic acid is a weak acid. Which statement about hydrochloric

  5. Chemistry

    What is the final pH of the second dilution after adding 1 drop of 0.1 M NaOH? There were 2 ml of buffer per well Calculate the final pH of the undiluted buffer after 0.25 ml of 0.1M NaOH is added. The Ka of CH3 COOH = 1.8 x 10 power -5. Use the CH3COOH

  6. Chemistry - Science (Dr. Bob222)

    The following reaction has a positive value of ΔG°. 2H2O(g) → 2H2(g) + O2(g) Which of the following statements must be true? A. The reaction is slow. B. The reaction will not occur. That is, when H2O(g) is introduced into a flask, no O2 or H2 will form

  7. chemistry

    Write an equation to represent the dissociation of propionic acid (CH3CH2COOH) in water. (Type your answer using the format H2O for H2O and [NH4]+ for NH4+. Use the lowest possible coefficients.)

  8. Chemistry

    Complete the following acid-base reaction with balanced molecular, total ionic and net ionic equations: calcium hydroxide (aq) + acetic acid (aq) ----> ? I know that calcium hydroxide is ca(OH)2 and that acetic acid is CH3COOH. I also know that one of the

  9. Chemistry Help Please!!!

    Find Net Ionic equation for hydrolysis , Expression for equilibrium constant (Ka or Kb) and Value of (Ka or Kb) Net Ionic equations I've got NaC2H3O2 == CH3COO^-+H2O -->CH3COOH+OH^- Na2CO3 ==== CO3 + 2H2O → H2CO3 + 2-OH Kb = [H2CO3] [-OH]2 / [CO3]. Kb =

  10. chemistry

    Using dissociation constants from Appendix D in the textbook, determine the value for the equilibrium constant for each of the following reactions. (Remember that when reactions are added, the corresponding equilibrium constants are multiplied.) (i)

Still need help?

You can ask a new question or browse existing questions.