Ask questions and get helpful answers.

What is the equilibrium expression for the following acid dissociation reaction?

CH3COOH + H2O --><-- CH3COO- + H3O+

A. [CH3COO-][H3O+]/[CH3COOH][H3O]
B. [CH3COOH][H2O]/[CH3COO-][H3O+]
C. [CH3COOH]/[CH3COO-][H3O-]
D. [CH3COO-][H3O+]/[CH3COOH]

How do you do this problem. Can somebody help me out please?

  1. 👍
  2. 👎
  3. 👁
  4. ℹ️
  5. 🚩
3 answers
  1. In equilibrium expressions it's the right hand side divided by the left hand side with each concentration raised to a power indicated by the coefficient in the balanced equation. Did you make a typo in A? Did you intend to write
    [CH3COO-][H3O+]/[CH3COOH][H2O]

    1. 👍
    2. 👎
    3. ℹ️
    4. 🚩
    👤
    DrBob222
  2. The answer is D

    1. 👍
    2. 👎
    3. ℹ️
    4. 🚩
  3. DrBob tbh

    1. 👍
    2. 👎
    3. ℹ️
    4. 🚩

Answer this Question

Related Questions

Still need help?

You can ask a new question or browse existing questions.